 |
|
 |
|
|
 |
 |
 |
 |
|
 |
|
 |
|
DL-Methionine Feed Grade
Sumitomo Chemical’s DL-Methionine Feed Grade comes in the form
of crystal or crystalline powder with characteristic odor and slightly
sweet taste, which is suitable for use in premix and compound feed.
Composition: DL-2-amino-4-(methylthio) butyric acid
CAS No. 59-51-8
CH3-S-CH2-CH2-CH(NH2)-COOH
Specification: Purity 99%
min.
Loss on drying 0.3% max.
Packing : 25kg in paper bags
1,000kg in big bags |
|
 |
 |
|
Methionine Hydroxy Analog Feed Grade (Liquid Methionine)
Sumitomo Chemical’s liquid methionine is the feed additive,
which contains 2-hydroxy-4-(methylthio) butanoic acid by minimum 88%.
This product is dark brown in color, appears as slightly viscous liquid
and has a peculiar smell.
Composition: 2-hydroxy-4-(methylthio) butanoic acid
CAS No. 583-91-5
CH3-S-CH2-CH2-CH(OH)-COOH
Specification: Methionine Hydroxy Analog 88% min.
Water Content
12% max.
Packing : 250kg in blue drums
1,150kg in Intermediate Bulk Containers |
|
 |
|
| |
| |
|
 |
 |
| |
|
|